C22H30N4O2 — CID 46470503
4-tert-butyl-N-[1-[[2-(dimethylamino)-3-pyridinyl]methylamino]-1-oxopropan-2-yl]benzamide (PubChem CID 46470503) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[[2-(dimethylamino)-3-pyridinyl]methylamino]-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-[[2-(dimethylamino)-3-pyridinyl]methylamino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 46470503 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 4-tert-butyl-N-[1-[[2-(dimethylamino)-3-pyridinyl]methylamino]-1-oxopropan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)NCc1cccnc1N(C)C |
| InChI | InChI=1S/C22H30N4O2/c1-15(20(27)24-14-17-8-7-13-23-19(17)26(5)6)25-21(28)16-9-11-18(12-10-16)22(2,3)4/h7-13,15H,14H2,1-6H3,(H,24,27)(H,25,28) |
| InChIKey | STJPCUDQLWFGMK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |