C21H19F3N2O3 — CID 56585798
N-(3-quinolin-8-yloxypropyl)-2-[4-(trifluoromethyl)phenoxy]acetamide (PubChem CID 56585798) has the molecular formula C21H19F3N2O3 and a molecular weight of 404.39 g/mol. Its IUPAC name is N-(3-quinolin-8-yloxypropyl)-2-[4-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-(3-quinolin-8-yloxypropyl)-2-[4-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 56585798 |
| Molecular Formula | C21H19F3N2O3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-(3-quinolin-8-yloxypropyl)-2-[4-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(F)(F)F)cc1)NCCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C21H19F3N2O3/c22-21(23,24)16-7-9-17(10-8-16)29-14-19(27)25-12-3-13-28-18-6-1-4-15-5-2-11-26-20(15)18/h1-2,4-11H,3,12-14H2,(H,25,27) |
| InChIKey | VSOPLSWFOCFGCA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|