C20H18F3N3O2S — CID 56534857
N-(3-quinolin-8-yloxypropyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide (PubChem CID 56534857) has the molecular formula C20H18F3N3O2S and a molecular weight of 421.44 g/mol. Its IUPAC name is N-(3-quinolin-8-yloxypropyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-(3-quinolin-8-yloxypropyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 56534857 |
| Molecular Formula | C20H18F3N3O2S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-(3-quinolin-8-yloxypropyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cn1)NCCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C20H18F3N3O2S/c21-20(22,23)15-7-8-18(26-12-15)29-13-17(27)24-10-3-11-28-16-6-1-4-14-5-2-9-25-19(14)16/h1-2,4-9,12H,3,10-11,13H2,(H,24,27) |
| InChIKey | QBILPIJBKWZDGM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|