C22H22N4O5 — CID 56535094
3-nitro-N-[1-oxo-1-(3-quinolin-8-yloxypropylamino)propan-2-yl]benzamide (PubChem CID 56535094) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 3-nitro-N-[1-oxo-1-(3-quinolin-8-yloxypropylamino)propan-2-yl]benzamide.
| Compound Name | 3-nitro-N-[1-oxo-1-(3-quinolin-8-yloxypropylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 56535094 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-nitro-N-[1-oxo-1-(3-quinolin-8-yloxypropylamino)propan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)NCCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C22H22N4O5/c1-15(25-22(28)17-7-2-9-18(14-17)26(29)30)21(27)24-12-5-13-31-19-10-3-6-16-8-4-11-23-20(16)19/h2-4,6-11,14-15H,5,12-13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | OBCZNONPINZIOI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|