C12H17ClN4O4 — CID 119382495
N-[1-(2-aminoethylamino)-1-oxopropan-2-yl]-3-nitrobenzamide;hydrochloride (PubChem CID 119382495) has the molecular formula C12H17ClN4O4 and a molecular weight of 316.75 g/mol. Its IUPAC name is N-[1-(2-aminoethylamino)-1-oxopropan-2-yl]-3-nitrobenzamide;hydrochloride.
| Compound Name | N-[1-(2-aminoethylamino)-1-oxopropan-2-yl]-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119382495 |
| Molecular Formula | C12H17ClN4O4 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[1-(2-aminoethylamino)-1-oxopropan-2-yl]-3-nitrobenzamide;hydrochloride |
| SMILES | CC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)NCCN.Cl |
| InChI | InChI=1S/C12H16N4O4.ClH/c1-8(11(17)14-6-5-13)15-12(18)9-3-2-4-10(7-9)16(19)20;/h2-4,7-8H,5-6,13H2,1H3,(H,14,17)(H,15,18);1H |
| InChIKey | UQTZSSBGKMXLII-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|