C27H27N3O3 — CID 56544237
3,5-dimethyl-4-(pyridin-3-ylmethoxy)-N-(3-quinolin-8-yloxypropyl)benzamide (PubChem CID 56544237) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3,5-dimethyl-4-(pyridin-3-ylmethoxy)-N-(3-quinolin-8-yloxypropyl)benzamide.
| Compound Name | 3,5-dimethyl-4-(pyridin-3-ylmethoxy)-N-(3-quinolin-8-yloxypropyl)benzamide |
|---|---|
| PubChem CID | 56544237 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 3,5-dimethyl-4-(pyridin-3-ylmethoxy)-N-(3-quinolin-8-yloxypropyl)benzamide |
| SMILES | Cc1cc(C(=O)NCCCOc2cccc3cccnc23)cc(C)c1OCc1cccnc1 |
| InChI | InChI=1S/C27H27N3O3/c1-19-15-23(16-20(2)26(19)33-18-21-7-4-11-28-17-21)27(31)30-13-6-14-32-24-10-3-8-22-9-5-12-29-25(22)24/h3-5,7-12,15-17H,6,13-14,18H2,1-2H3,(H,30,31) |
| InChIKey | DZKQDIMFJWUYDF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|