C26H31N3O2 — CID 46453709
N-[3-[4-(dimethylamino)phenyl]propyl]-3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzamide (PubChem CID 46453709) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[3-[4-(dimethylamino)phenyl]propyl]-3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | N-[3-[4-(dimethylamino)phenyl]propyl]-3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46453709 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[3-[4-(dimethylamino)phenyl]propyl]-3,5-dimethyl-4-(pyridin-3-ylmethoxy)benzamide |
| SMILES | Cc1cc(C(=O)NCCCc2ccc(N(C)C)cc2)cc(C)c1OCc1cccnc1 |
| InChI | InChI=1S/C26H31N3O2/c1-19-15-23(16-20(2)25(19)31-18-22-8-5-13-27-17-22)26(30)28-14-6-7-21-9-11-24(12-10-21)29(3)4/h5,8-13,15-17H,6-7,14,18H2,1-4H3,(H,28,30) |
| InChIKey | QSHTWLJILPTLQR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|