C23H22N4O2S — CID 56585582
3-cyano-6-cyclopropyl-2-methylsulfanyl-N-(3-quinolin-8-yloxypropyl)pyridine-4-carboxamide (PubChem CID 56585582) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 3-cyano-6-cyclopropyl-2-methylsulfanyl-N-(3-quinolin-8-yloxypropyl)pyridine-4-carboxamide.
| Compound Name | 3-cyano-6-cyclopropyl-2-methylsulfanyl-N-(3-quinolin-8-yloxypropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 56585582 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3-cyano-6-cyclopropyl-2-methylsulfanyl-N-(3-quinolin-8-yloxypropyl)pyridine-4-carboxamide |
| SMILES | CSc1nc(C2CC2)cc(C(=O)NCCCOc2cccc3cccnc23)c1C#N |
| InChI | InChI=1S/C23H22N4O2S/c1-30-23-18(14-24)17(13-19(27-23)15-8-9-15)22(28)26-11-4-12-29-20-7-2-5-16-6-3-10-25-21(16)20/h2-3,5-7,10,13,15H,4,8-9,11-12H2,1H3,(H,26,28) |
| InChIKey | DYGMETKWTFOSFH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|