C24H29N5OS — CID 33136416
3-cyano-6-cyclopropyl-2-methylsulfanyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridine-4-carboxamide (PubChem CID 33136416) has the molecular formula C24H29N5OS and a molecular weight of 435.60 g/mol. Its IUPAC name is 3-cyano-6-cyclopropyl-2-methylsulfanyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridine-4-carboxamide.
| Compound Name | 3-cyano-6-cyclopropyl-2-methylsulfanyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 33136416 |
| Molecular Formula | C24H29N5OS |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 3-cyano-6-cyclopropyl-2-methylsulfanyl-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridine-4-carboxamide |
| SMILES | CSc1nc(C2CC2)cc(C(=O)NCCCN2CCN(c3ccccc3)CC2)c1C#N |
| InChI | InChI=1S/C24H29N5OS/c1-31-24-21(17-25)20(16-22(27-24)18-8-9-18)23(30)26-10-5-11-28-12-14-29(15-13-28)19-6-3-2-4-7-19/h2-4,6-7,16,18H,5,8-15H2,1H3,(H,26,30) |
| InChIKey | OHHVXHOQUHXSAC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|