C23H31N5O2 — CID 86891495
2-N,2-N,6-trimethyl-5-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridine-2,5-dicarboxamide (PubChem CID 86891495) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-N,2-N,6-trimethyl-5-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,2-N,6-trimethyl-5-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 86891495 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 2-N,2-N,6-trimethyl-5-N-[3-(4-phenylpiperazin-1-yl)propyl]pyridine-2,5-dicarboxamide |
| SMILES | Cc1nc(C(=O)N(C)C)ccc1C(=O)NCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N5O2/c1-18-20(10-11-21(25-18)23(30)26(2)3)22(29)24-12-7-13-27-14-16-28(17-15-27)19-8-5-4-6-9-19/h4-6,8-11H,7,12-17H2,1-3H3,(H,24,29) |
| InChIKey | DUOTVPSUPYUNSV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|