C18H16N2O5S — CID 113102285
N-(2-quinolin-8-yloxyethyl)-1,3-benzodioxole-5-sulfonamide (PubChem CID 113102285) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is N-(2-quinolin-8-yloxyethyl)-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-(2-quinolin-8-yloxyethyl)-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 113102285 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-(2-quinolin-8-yloxyethyl)-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(NCCOc1cccc2cccnc12)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16N2O5S/c21-26(22,14-6-7-15-17(11-14)25-12-24-15)20-9-10-23-16-5-1-3-13-4-2-8-19-18(13)16/h1-8,11,20H,9-10,12H2 |
| InChIKey | AIGVEQBYLSPBRH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|