C19H20N2O5S2 — CID 56541916
3-methylsulfonyl-N-(3-quinolin-8-yloxypropyl)benzenesulfonamide (PubChem CID 56541916) has the molecular formula C19H20N2O5S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-methylsulfonyl-N-(3-quinolin-8-yloxypropyl)benzenesulfonamide.
| Compound Name | 3-methylsulfonyl-N-(3-quinolin-8-yloxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 56541916 |
| Molecular Formula | C19H20N2O5S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3-methylsulfonyl-N-(3-quinolin-8-yloxypropyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)NCCCOc2cccc3cccnc23)c1 |
| InChI | InChI=1S/C19H20N2O5S2/c1-27(22,23)16-8-3-9-17(14-16)28(24,25)21-12-5-13-26-18-10-2-6-15-7-4-11-20-19(15)18/h2-4,6-11,14,21H,5,12-13H2,1H3 |
| InChIKey | ILMYFTLWQGRLOT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|