C19H20N2O3S — CID 113102271
3,4-dimethyl-N-(2-quinolin-8-yloxyethyl)benzenesulfonamide (PubChem CID 113102271) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 3,4-dimethyl-N-(2-quinolin-8-yloxyethyl)benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-(2-quinolin-8-yloxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113102271 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3,4-dimethyl-N-(2-quinolin-8-yloxyethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCOc2cccc3cccnc23)cc1C |
| InChI | InChI=1S/C19H20N2O3S/c1-14-8-9-17(13-15(14)2)25(22,23)21-11-12-24-18-7-3-5-16-6-4-10-20-19(16)18/h3-10,13,21H,11-12H2,1-2H3 |
| InChIKey | VWKVLOQOHDWHGB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|