C24H19N3O5S — CID 17425201
3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-quinolin-8-ylbenzamide (PubChem CID 17425201) has the molecular formula C24H19N3O5S and a molecular weight of 461.50 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-quinolin-8-ylbenzamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-quinolin-8-ylbenzamide |
|---|---|
| PubChem CID | 17425201 |
| Molecular Formula | C24H19N3O5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-quinolin-8-ylbenzamide |
| SMILES | O=C(Nc1cccc2cccnc12)c1cccc(S(=O)(=O)NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C24H19N3O5S/c28-24(27-20-8-2-4-17-6-3-11-25-23(17)20)18-5-1-7-19(13-18)33(29,30)26-14-16-9-10-21-22(12-16)32-15-31-21/h1-13,26H,14-15H2,(H,27,28) |
| InChIKey | PDYVNCCACQWHGK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |