C20H19N3O3 — CID 109022845
3-(1,3-benzodioxol-5-ylmethylamino)-N-quinolin-8-ylpropanamide (PubChem CID 109022845) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylamino)-N-quinolin-8-ylpropanamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylamino)-N-quinolin-8-ylpropanamide |
|---|---|
| PubChem CID | 109022845 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylamino)-N-quinolin-8-ylpropanamide |
| SMILES | O=C(CCNCc1ccc2c(c1)OCO2)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C20H19N3O3/c24-19(23-16-5-1-3-15-4-2-9-22-20(15)16)8-10-21-12-14-6-7-17-18(11-14)26-13-25-17/h1-7,9,11,21H,8,10,12-13H2,(H,23,24) |
| InChIKey | ZTPQLGMQESQQAU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|