C20H19N3O3 — CID 86864145
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(quinolin-8-ylmethyl)urea (PubChem CID 86864145) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(quinolin-8-ylmethyl)urea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(quinolin-8-ylmethyl)urea |
|---|---|
| PubChem CID | 86864145 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(quinolin-8-ylmethyl)urea |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)NCc1cccc2cccnc12 |
| InChI | InChI=1S/C20H19N3O3/c24-20(22-10-8-14-6-7-17-18(11-14)26-13-25-17)23-12-16-4-1-3-15-5-2-9-21-19(15)16/h1-7,9,11H,8,10,12-13H2,(H2,22,23,24) |
| InChIKey | JYOPUMTXNUBGMH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |