C22H19N3O4 — CID 51294095
5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-3-(quinolin-8-ylmethyl)imidazolidine-2,4-dione (PubChem CID 51294095) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-3-(quinolin-8-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-3-(quinolin-8-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51294095 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-3-(quinolin-8-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CC1(Cc2ccc3c(c2)OCO3)NC(=O)N(Cc2cccc3cccnc23)C1=O |
| InChI | InChI=1S/C22H19N3O4/c1-22(11-14-7-8-17-18(10-14)29-13-28-17)20(26)25(21(27)24-22)12-16-5-2-4-15-6-3-9-23-19(15)16/h2-10H,11-13H2,1H3,(H,24,27) |
| InChIKey | DTTJJNBJPVPOOC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|