C17H17N3O2 — CID 17450906
3-(quinolin-8-ylmethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 17450906) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-(quinolin-8-ylmethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-(quinolin-8-ylmethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 17450906 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 3-(quinolin-8-ylmethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1Cc1cccc2cccnc12 |
| InChI | InChI=1S/C17H17N3O2/c21-15-17(8-1-2-9-17)19-16(22)20(15)11-13-6-3-5-12-7-4-10-18-14(12)13/h3-7,10H,1-2,8-9,11H2,(H,19,22) |
| InChIKey | AAQKEVHFLPIHIZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|