C22H26N4O4 — CID 56585413
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-quinolin-8-yloxypropyl)propanamide (PubChem CID 56585413) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-quinolin-8-yloxypropyl)propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-quinolin-8-yloxypropyl)propanamide |
|---|---|
| PubChem CID | 56585413 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-quinolin-8-yloxypropyl)propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCC2)C1=O)NCCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C22H26N4O4/c27-18(9-14-26-20(28)22(25-21(26)29)10-1-2-11-22)23-13-5-15-30-17-8-3-6-16-7-4-12-24-19(16)17/h3-4,6-8,12H,1-2,5,9-11,13-15H2,(H,23,27)(H,25,29) |
| InChIKey | VCQCDEFLZVWZHA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|