C17H16N4O4 — CID 131938467
2-(3,6-dioxo-1,2-dihydropyridazin-4-yl)-N-(2-quinolin-8-yloxyethyl)acetamide (PubChem CID 131938467) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(3,6-dioxo-1,2-dihydropyridazin-4-yl)-N-(2-quinolin-8-yloxyethyl)acetamide.
| Compound Name | 2-(3,6-dioxo-1,2-dihydropyridazin-4-yl)-N-(2-quinolin-8-yloxyethyl)acetamide |
|---|---|
| PubChem CID | 131938467 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(3,6-dioxo-1,2-dihydropyridazin-4-yl)-N-(2-quinolin-8-yloxyethyl)acetamide |
| SMILES | O=C(Cc1cc(=O)[nH][nH]c1=O)NCCOc1cccc2cccnc12 |
| InChI | InChI=1S/C17H16N4O4/c22-14(9-12-10-15(23)20-21-17(12)24)18-7-8-25-13-5-1-3-11-4-2-6-19-16(11)13/h1-6,10H,7-9H2,(H,18,22)(H,20,23)(H,21,24) |
| InChIKey | WWRIKBBFVKOBMT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|