C14H13N3O2 — CID 81426474
3-(quinolin-8-ylmethylamino)pyrrolidine-2,5-dione (PubChem CID 81426474) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-(quinolin-8-ylmethylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(quinolin-8-ylmethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 81426474 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 3-(quinolin-8-ylmethylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCc2cccc3cccnc23)C(=O)N1 |
| InChI | InChI=1S/C14H13N3O2/c18-12-7-11(14(19)17-12)16-8-10-4-1-3-9-5-2-6-15-13(9)10/h1-6,11,16H,7-8H2,(H,17,18,19) |
| InChIKey | XMSPTFZPLZNXDR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|