C8H9N3O2S — CID 61284446
3-(1,3-thiazol-2-ylmethylamino)pyrrolidine-2,5-dione (PubChem CID 61284446) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-ylmethylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(1,3-thiazol-2-ylmethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61284446 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 3-(1,3-thiazol-2-ylmethylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCc2nccs2)C(=O)N1 |
| InChI | InChI=1S/C8H9N3O2S/c12-6-3-5(8(13)11-6)10-4-7-9-1-2-14-7/h1-2,5,10H,3-4H2,(H,11,12,13) |
| InChIKey | GPTXRIDADAJXEG-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|