C9H10N2OS — CID 104788357
3-(1,3-thiazol-2-ylmethylamino)cyclopent-2-en-1-one (PubChem CID 104788357) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-ylmethylamino)cyclopent-2-en-1-one.
| Compound Name | 3-(1,3-thiazol-2-ylmethylamino)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 104788357 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 3-(1,3-thiazol-2-ylmethylamino)cyclopent-2-en-1-one |
| SMILES | O=C1C=C(NCc2nccs2)CC1 |
| InChI | InChI=1S/C9H10N2OS/c12-8-2-1-7(5-8)11-6-9-10-3-4-13-9/h3-5,11H,1-2,6H2 |
| InChIKey | JYVNFZKMWUYKFC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |