C10H11N3OS — CID 63655578
6-methoxy-N-(1,3-thiazol-2-ylmethyl)pyridin-3-amine (PubChem CID 63655578) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is 6-methoxy-N-(1,3-thiazol-2-ylmethyl)pyridin-3-amine.
| Compound Name | 6-methoxy-N-(1,3-thiazol-2-ylmethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 63655578 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 6-methoxy-N-(1,3-thiazol-2-ylmethyl)pyridin-3-amine |
| SMILES | COc1ccc(NCc2nccs2)cn1 |
| InChI | InChI=1S/C10H11N3OS/c1-14-9-3-2-8(6-13-9)12-7-10-11-4-5-15-10/h2-6,12H,7H2,1H3 |
| InChIKey | QUIMICRKDMUPLB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |