About 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine
6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine (PubChem CID 115320492) has the molecular formula C10H12N4OS
and a molecular weight of 236.30 g/mol. Its IUPAC name is 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine |
| PubChem CID | 115320492 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine |
| SMILES | COc1ccc(N)c(NCc2nccs2)n1 |
| InChI | InChI=1S/C10H12N4OS/c1-15-8-3-2-7(11)10(14-8)13-6-9-12-4-5-16-9/h2-5H,6,11H2,1H3,(H,13,14) |
| InChIKey | PSDVRCYHVPQHHS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine?
The IUPAC name of 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine (CID 115320492) is 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine.
What is the SMILES notation for 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine?
The canonical SMILES for 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine is COc1ccc(N)c(NCc2nccs2)n1.
What is the InChIKey of 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine?
The InChIKey is PSDVRCYHVPQHHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4OS/c1-15-8-3-2-7(11)10(14-8)13-6-9-12-4-5-16-9/h2-5H,6,11H2,1H3,(H,13,14).
What are the key properties of 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine?
6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine has a molecular weight of 236.30 g/mol, XLogP of 1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine is sourced from PubChem (CID 115320492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).