C10H12N4OS — CID 115320492
6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine (PubChem CID 115320492) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine.
| Compound Name | 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 115320492 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 6-methoxy-2-N-(1,3-thiazol-2-ylmethyl)pyridine-2,3-diamine |
| SMILES | COc1ccc(N)c(NCc2nccs2)n1 |
| InChI | InChI=1S/C10H12N4OS/c1-15-8-3-2-7(11)10(14-8)13-6-9-12-4-5-16-9/h2-5H,6,11H2,1H3,(H,13,14) |
| InChIKey | PSDVRCYHVPQHHS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |