C10H17N3O — CID 115320288
2-N-butyl-6-methoxypyridine-2,3-diamine (PubChem CID 115320288) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-N-butyl-6-methoxypyridine-2,3-diamine.
| Compound Name | 2-N-butyl-6-methoxypyridine-2,3-diamine |
|---|---|
| PubChem CID | 115320288 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 2-N-butyl-6-methoxypyridine-2,3-diamine |
| SMILES | CCCCNc1nc(OC)ccc1N |
| InChI | InChI=1S/C10H17N3O/c1-3-4-7-12-10-8(11)5-6-9(13-10)14-2/h5-6H,3-4,7,11H2,1-2H3,(H,12,13) |
| InChIKey | OWNYMHRAAXAZNW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|