C14H25N3O — CID 114004558
2-N-(2-ethylhexyl)-6-methoxypyridine-2,3-diamine (PubChem CID 114004558) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-N-(2-ethylhexyl)-6-methoxypyridine-2,3-diamine.
| Compound Name | 2-N-(2-ethylhexyl)-6-methoxypyridine-2,3-diamine |
|---|---|
| PubChem CID | 114004558 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-N-(2-ethylhexyl)-6-methoxypyridine-2,3-diamine |
| SMILES | CCCCC(CC)CNc1nc(OC)ccc1N |
| InChI | InChI=1S/C14H25N3O/c1-4-6-7-11(5-2)10-16-14-12(15)8-9-13(17-14)18-3/h8-9,11H,4-7,10,15H2,1-3H3,(H,16,17) |
| InChIKey | HVVDJUIUDPGTPB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |