C15H26N2 — CID 107819815
4-N-(2-ethylhexyl)-2-methylbenzene-1,4-diamine (PubChem CID 107819815) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 4-N-(2-ethylhexyl)-2-methylbenzene-1,4-diamine.
| Compound Name | 4-N-(2-ethylhexyl)-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 107819815 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 4-N-(2-ethylhexyl)-2-methylbenzene-1,4-diamine |
| SMILES | CCCCC(CC)CNc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C15H26N2/c1-4-6-7-13(5-2)11-17-14-8-9-15(16)12(3)10-14/h8-10,13,17H,4-7,11,16H2,1-3H3 |
| InChIKey | KLVOWCHPDKPMMF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|