C14H25N3 — CID 107819841
2-N-(2-ethylhexyl)-3-methylpyridine-2,5-diamine (PubChem CID 107819841) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is 2-N-(2-ethylhexyl)-3-methylpyridine-2,5-diamine.
| Compound Name | 2-N-(2-ethylhexyl)-3-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 107819841 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2-N-(2-ethylhexyl)-3-methylpyridine-2,5-diamine |
| SMILES | CCCCC(CC)CNc1ncc(N)cc1C |
| InChI | InChI=1S/C14H25N3/c1-4-6-7-12(5-2)9-16-14-11(3)8-13(15)10-17-14/h8,10,12H,4-7,9,15H2,1-3H3,(H,16,17) |
| InChIKey | DUYFBPOHYDMXIS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |