C11H21N3S — CID 107819500
5-N-(2-ethylhexyl)-1,2-thiazole-3,5-diamine (PubChem CID 107819500) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 5-N-(2-ethylhexyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(2-ethylhexyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 107819500 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5-N-(2-ethylhexyl)-1,2-thiazole-3,5-diamine |
| SMILES | CCCCC(CC)CNc1cc(N)ns1 |
| InChI | InChI=1S/C11H21N3S/c1-3-5-6-9(4-2)8-13-11-7-10(12)14-15-11/h7,9,13H,3-6,8H2,1-2H3,(H2,12,14) |
| InChIKey | FDPAFHTWCVEXBK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |