C14H19Cl2N3S — CID 65475057
5,7-dichloro-N-(2-ethylhexyl)-2,1,3-benzothiadiazol-4-amine (PubChem CID 65475057) has the molecular formula C14H19Cl2N3S and a molecular weight of 332.30 g/mol. Its IUPAC name is 5,7-dichloro-N-(2-ethylhexyl)-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5,7-dichloro-N-(2-ethylhexyl)-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 65475057 |
| Molecular Formula | C14H19Cl2N3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 5,7-dichloro-N-(2-ethylhexyl)-2,1,3-benzothiadiazol-4-amine |
| SMILES | CCCCC(CC)CNc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C14H19Cl2N3S/c1-3-5-6-9(4-2)8-17-12-10(15)7-11(16)13-14(12)19-20-18-13/h7,9,17H,3-6,8H2,1-2H3 |
| InChIKey | ZGLHPOCITLYPSK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |