C10H20N4S — CID 107818817
5-N-(2-ethylhexyl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 107818817) has the molecular formula C10H20N4S and a molecular weight of 228.36 g/mol. Its IUPAC name is 5-N-(2-ethylhexyl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-(2-ethylhexyl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 107818817 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 5-N-(2-ethylhexyl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CCCCC(CC)CNc1nc(N)ns1 |
| InChI | InChI=1S/C10H20N4S/c1-3-5-6-8(4-2)7-12-10-13-9(11)14-15-10/h8H,3-7H2,1-2H3,(H3,11,12,13,14) |
| InChIKey | IEFLDXFBZAHEPA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |