C16H25N3S — CID 107819793
5-N-(2-ethylhexyl)-2-methyl-1,3-benzothiazole-5,6-diamine (PubChem CID 107819793) has the molecular formula C16H25N3S and a molecular weight of 291.46 g/mol. Its IUPAC name is 5-N-(2-ethylhexyl)-2-methyl-1,3-benzothiazole-5,6-diamine.
| Compound Name | 5-N-(2-ethylhexyl)-2-methyl-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 107819793 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 5-N-(2-ethylhexyl)-2-methyl-1,3-benzothiazole-5,6-diamine |
| SMILES | CCCCC(CC)CNc1cc2nc(C)sc2cc1N |
| InChI | InChI=1S/C16H25N3S/c1-4-6-7-12(5-2)10-18-14-9-15-16(8-13(14)17)20-11(3)19-15/h8-9,12,18H,4-7,10,17H2,1-3H3 |
| InChIKey | RSGVCCLFVBITIV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|