C14H15N3OS2 — CID 106434522
2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-1-thiophen-3-ylethanol (PubChem CID 106434522) has the molecular formula C14H15N3OS2 and a molecular weight of 305.43 g/mol. Its IUPAC name is 2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106434522 |
| Molecular Formula | C14H15N3OS2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-1-thiophen-3-ylethanol |
| SMILES | Cc1nc2cc(NCC(O)c3ccsc3)c(N)cc2s1 |
| InChI | InChI=1S/C14H15N3OS2/c1-8-17-12-5-11(10(15)4-14(12)20-8)16-6-13(18)9-2-3-19-7-9/h2-5,7,13,16,18H,6,15H2,1H3 |
| InChIKey | MSZKJPZIZBAENB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|