C11H14N4OS — CID 114188663
2-[[6-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol (PubChem CID 114188663) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-[[6-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[[6-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 114188663 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-[[6-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol |
| SMILES | CNc1cc(NCC(O)c2ccsc2)ncn1 |
| InChI | InChI=1S/C11H14N4OS/c1-12-10-4-11(15-7-14-10)13-5-9(16)8-2-3-17-6-8/h2-4,6-7,9,16H,5H2,1H3,(H2,12,13,14,15) |
| InChIKey | RIYIVLCDFKCWOT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |