C12H16N4OS — CID 106436448
2-[[6-methyl-2-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol (PubChem CID 106436448) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-[[6-methyl-2-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[[6-methyl-2-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106436448 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[[6-methyl-2-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol |
| SMILES | CNc1nc(C)cc(NCC(O)c2ccsc2)n1 |
| InChI | InChI=1S/C12H16N4OS/c1-8-5-11(16-12(13-2)15-8)14-6-10(17)9-3-4-18-7-9/h3-5,7,10,17H,6H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | CSKPWBLNWORNRH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |