C13H18N4OS — CID 106436437
2-[[2-(propylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol (PubChem CID 106436437) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[[2-(propylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[[2-(propylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106436437 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[[2-(propylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol |
| SMILES | CCCNc1nccc(NCC(O)c2ccsc2)n1 |
| InChI | InChI=1S/C13H18N4OS/c1-2-5-14-13-15-6-3-12(17-13)16-8-11(18)10-4-7-19-9-10/h3-4,6-7,9,11,18H,2,5,8H2,1H3,(H2,14,15,16,17) |
| InChIKey | QBZYJWADUVRRLQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |