C12H12N2O3S — CID 106435556
2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]pyridine-4-carboxylic acid (PubChem CID 106435556) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]pyridine-4-carboxylic acid.
| Compound Name | 2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106435556 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(NCC(O)c2ccsc2)c1 |
| InChI | InChI=1S/C12H12N2O3S/c15-10(9-2-4-18-7-9)6-14-11-5-8(12(16)17)1-3-13-11/h1-5,7,10,15H,6H2,(H,13,14)(H,16,17) |
| InChIKey | OWRQHIYCDPLBTN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |