C13H12N2O5S — CID 106435567
4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-3-nitrobenzoic acid (PubChem CID 106435567) has the molecular formula C13H12N2O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is 4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-3-nitrobenzoic acid.
| Compound Name | 4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 106435567 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-[(2-hydroxy-2-thiophen-3-ylethyl)amino]-3-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc(NCC(O)c2ccsc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N2O5S/c16-12(9-3-4-21-7-9)6-14-10-2-1-8(13(17)18)5-11(10)15(19)20/h1-5,7,12,14,16H,6H2,(H,17,18) |
| InChIKey | XABQBVMLBQOKIY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|