C19H23N3O4 — CID 133375929
4-[[2-hydroxy-2-(3-methylphenyl)ethyl]amino]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 133375929) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[[2-hydroxy-2-(3-methylphenyl)ethyl]amino]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[[2-hydroxy-2-(3-methylphenyl)ethyl]amino]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 133375929 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[[2-hydroxy-2-(3-methylphenyl)ethyl]amino]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | Cc1cccc(C(O)CNc2ccc(C(=O)NC(C)C)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H23N3O4/c1-12(2)21-19(24)15-7-8-16(17(10-15)22(25)26)20-11-18(23)14-6-4-5-13(3)9-14/h4-10,12,18,20,23H,11H2,1-3H3,(H,21,24) |
| InChIKey | GRVWJQKWHDFNDO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|