C16H15F3N2O5S — CID 133375930
1-(3-methylphenyl)-2-[2-nitro-4-(trifluoromethylsulfonyl)anilino]ethanol (PubChem CID 133375930) has the molecular formula C16H15F3N2O5S and a molecular weight of 404.37 g/mol. Its IUPAC name is 1-(3-methylphenyl)-2-[2-nitro-4-(trifluoromethylsulfonyl)anilino]ethanol.
| Compound Name | 1-(3-methylphenyl)-2-[2-nitro-4-(trifluoromethylsulfonyl)anilino]ethanol |
|---|---|
| PubChem CID | 133375930 |
| Molecular Formula | C16H15F3N2O5S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 1-(3-methylphenyl)-2-[2-nitro-4-(trifluoromethylsulfonyl)anilino]ethanol |
| SMILES | Cc1cccc(C(O)CNc2ccc(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15F3N2O5S/c1-10-3-2-4-11(7-10)15(22)9-20-13-6-5-12(8-14(13)21(23)24)27(25,26)16(17,18)19/h2-8,15,20,22H,9H2,1H3 |
| InChIKey | HIJXXNSNSOJWOV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|