C18H23N3O5S — CID 9311864
N-tert-butyl-4-[[(2S)-2-hydroxy-2-phenylethyl]amino]-3-nitrobenzenesulfonamide (PubChem CID 9311864) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-tert-butyl-4-[[(2S)-2-hydroxy-2-phenylethyl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | N-tert-butyl-4-[[(2S)-2-hydroxy-2-phenylethyl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9311864 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-tert-butyl-4-[[(2S)-2-hydroxy-2-phenylethyl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(NC[C@@H](O)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H23N3O5S/c1-18(2,3)20-27(25,26)14-9-10-15(16(11-14)21(23)24)19-12-17(22)13-7-5-4-6-8-13/h4-11,17,19-20,22H,12H2,1-3H3/t17-/m1/s1 |
| InChIKey | FHOTYXGXDQQARL-QGZVFWFLSA-N |
| XLogP | 2.82 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|