C12H11FN2O3S — CID 106435593
5-fluoro-2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]pyridine-3-carboxylic acid (PubChem CID 106435593) has the molecular formula C12H11FN2O3S and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-fluoro-2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 5-fluoro-2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 106435593 |
| Molecular Formula | C12H11FN2O3S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 5-fluoro-2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(F)cnc1NCC(O)c1ccsc1 |
| InChI | InChI=1S/C12H11FN2O3S/c13-8-3-9(12(17)18)11(14-4-8)15-5-10(16)7-1-2-19-6-7/h1-4,6,10,16H,5H2,(H,14,15)(H,17,18) |
| InChIKey | FYOJNOZZOXTEPS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |