C9H12BrNO2S — CID 106434930
3-bromo-N-(2-hydroxy-2-thiophen-3-ylethyl)propanamide (PubChem CID 106434930) has the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. Its IUPAC name is 3-bromo-N-(2-hydroxy-2-thiophen-3-ylethyl)propanamide.
| Compound Name | 3-bromo-N-(2-hydroxy-2-thiophen-3-ylethyl)propanamide |
|---|---|
| PubChem CID | 106434930 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 3-bromo-N-(2-hydroxy-2-thiophen-3-ylethyl)propanamide |
| SMILES | O=C(CCBr)NCC(O)c1ccsc1 |
| InChI | InChI=1S/C9H12BrNO2S/c10-3-1-9(13)11-5-8(12)7-2-4-14-6-7/h2,4,6,8,12H,1,3,5H2,(H,11,13) |
| InChIKey | DOTHOJSFDXWWGQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|