C14H22N2O3S — CID 103771643
6-acetamido-N-(2-hydroxy-2-thiophen-3-ylethyl)hexanamide (PubChem CID 103771643) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 6-acetamido-N-(2-hydroxy-2-thiophen-3-ylethyl)hexanamide.
| Compound Name | 6-acetamido-N-(2-hydroxy-2-thiophen-3-ylethyl)hexanamide |
|---|---|
| PubChem CID | 103771643 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 6-acetamido-N-(2-hydroxy-2-thiophen-3-ylethyl)hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCC(O)c1ccsc1 |
| InChI | InChI=1S/C14H22N2O3S/c1-11(17)15-7-4-2-3-5-14(19)16-9-13(18)12-6-8-20-10-12/h6,8,10,13,18H,2-5,7,9H2,1H3,(H,15,17)(H,16,19) |
| InChIKey | YIVMQJGYNPRCRM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|