C11H11ClN2OS — CID 103705029
2-[(5-chloro-2-pyridinyl)amino]-1-thiophen-3-ylethanol (PubChem CID 103705029) has the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(5-chloro-2-pyridinyl)amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 103705029 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)amino]-1-thiophen-3-ylethanol |
| SMILES | OC(CNc1ccc(Cl)cn1)c1ccsc1 |
| InChI | InChI=1S/C11H11ClN2OS/c12-9-1-2-11(13-5-9)14-6-10(15)8-3-4-16-7-8/h1-5,7,10,15H,6H2,(H,13,14) |
| InChIKey | NWQOJGIFBHKOMR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |