C12H13BrN2OS — CID 113412276
2-[(5-bromo-6-methyl-2-pyridinyl)amino]-1-thiophen-3-ylethanol (PubChem CID 113412276) has the molecular formula C12H13BrN2OS and a molecular weight of 313.22 g/mol. Its IUPAC name is 2-[(5-bromo-6-methyl-2-pyridinyl)amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(5-bromo-6-methyl-2-pyridinyl)amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 113412276 |
| Molecular Formula | C12H13BrN2OS |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 2-[(5-bromo-6-methyl-2-pyridinyl)amino]-1-thiophen-3-ylethanol |
| SMILES | Cc1nc(NCC(O)c2ccsc2)ccc1Br |
| InChI | InChI=1S/C12H13BrN2OS/c1-8-10(13)2-3-12(15-8)14-6-11(16)9-4-5-17-7-9/h2-5,7,11,16H,6H2,1H3,(H,14,15) |
| InChIKey | WZPBNCBESNXVMX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |