C11H13FN4OS — CID 106436412
2-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol (PubChem CID 106436412) has the molecular formula C11H13FN4OS and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106436412 |
| Molecular Formula | C11H13FN4OS |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol |
| SMILES | CNc1ncc(F)c(NCC(O)c2ccsc2)n1 |
| InChI | InChI=1S/C11H13FN4OS/c1-13-11-15-4-8(12)10(16-11)14-5-9(17)7-2-3-18-6-7/h2-4,6,9,17H,5H2,1H3,(H2,13,14,15,16) |
| InChIKey | LVRZPELWWBIXQT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |