C12H14N2O2S — CID 106435613
2-[(3-methoxy-2-pyridinyl)amino]-1-thiophen-3-ylethanol (PubChem CID 106435613) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[(3-methoxy-2-pyridinyl)amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(3-methoxy-2-pyridinyl)amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106435613 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-[(3-methoxy-2-pyridinyl)amino]-1-thiophen-3-ylethanol |
| SMILES | COc1cccnc1NCC(O)c1ccsc1 |
| InChI | InChI=1S/C12H14N2O2S/c1-16-11-3-2-5-13-12(11)14-7-10(15)9-4-6-17-8-9/h2-6,8,10,15H,7H2,1H3,(H,13,14) |
| InChIKey | LINKCYTWHIWMOD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |