C15H19NO3S — CID 106435231
2-[2-(2-methoxyphenoxy)ethylamino]-1-thiophen-3-ylethanol (PubChem CID 106435231) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenoxy)ethylamino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[2-(2-methoxyphenoxy)ethylamino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106435231 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-[2-(2-methoxyphenoxy)ethylamino]-1-thiophen-3-ylethanol |
| SMILES | COc1ccccc1OCCNCC(O)c1ccsc1 |
| InChI | InChI=1S/C15H19NO3S/c1-18-14-4-2-3-5-15(14)19-8-7-16-10-13(17)12-6-9-20-11-12/h2-6,9,11,13,16-17H,7-8,10H2,1H3 |
| InChIKey | ALNKLGFTQAIQDZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|